C20H24FNO3 — CID 110308819
4-(4-fluorophenyl)-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylbutanamide (PubChem CID 110308819) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylbutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 110308819 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-N-methylbutanamide |
| SMILES | COc1ccc(C(O)CN(C)C(=O)CCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FNO3/c1-22(14-19(23)16-8-12-18(25-2)13-9-16)20(24)5-3-4-15-6-10-17(21)11-7-15/h6-13,19,23H,3-5,14H2,1-2H3 |
| InChIKey | PHCTXBFSSIYTHQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |