C22H27NO5 — CID 110308829
N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N-methyl-5-oxopentanamide (PubChem CID 110308829) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N-methyl-5-oxopentanamide.
| Compound Name | N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 110308829 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N-methyl-5-oxopentanamide |
| SMILES | COc1ccc(C(=O)CCCC(=O)N(C)CC(O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-23(15-21(25)17-9-13-19(28-3)14-10-17)22(26)6-4-5-20(24)16-7-11-18(27-2)12-8-16/h7-14,21,25H,4-6,15H2,1-3H3 |
| InChIKey | KJNWXPURBMHVLN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |