C17H25N3O3 — CID 110309561
4-[3-(3-acetamidopropylamino)-3-oxopropyl]-N,N-dimethylbenzamide (PubChem CID 110309561) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-[3-(3-acetamidopropylamino)-3-oxopropyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-(3-acetamidopropylamino)-3-oxopropyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 110309561 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 4-[3-(3-acetamidopropylamino)-3-oxopropyl]-N,N-dimethylbenzamide |
| SMILES | CC(=O)NCCCNC(=O)CCc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-13(21)18-11-4-12-19-16(22)10-7-14-5-8-15(9-6-14)17(23)20(2)3/h5-6,8-9H,4,7,10-12H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | WUDGXDVJBXHDGA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|