C19H30N2O2 — CID 110617836
4-[3-(4,4-dimethylpentylamino)-3-oxopropyl]-N,N-dimethylbenzamide (PubChem CID 110617836) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-[3-(4,4-dimethylpentylamino)-3-oxopropyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-(4,4-dimethylpentylamino)-3-oxopropyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 110617836 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 4-[3-(4,4-dimethylpentylamino)-3-oxopropyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(CCC(=O)NCCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O2/c1-19(2,3)13-6-14-20-17(22)12-9-15-7-10-16(11-8-15)18(23)21(4)5/h7-8,10-11H,6,9,12-14H2,1-5H3,(H,20,22) |
| InChIKey | JXLLWUAAPMSKCP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|