C12H18O3 — CID 11031099
2'-methylspiro[1,3-dioxolane-2,6'-2,3,4,5,7,8-hexahydrochromene] (PubChem CID 11031099) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2'-methylspiro[1,3-dioxolane-2,6'-2,3,4,5,7,8-hexahydrochromene].
| Compound Name | 2'-methylspiro[1,3-dioxolane-2,6'-2,3,4,5,7,8-hexahydrochromene] |
|---|---|
| PubChem CID | 11031099 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2'-methylspiro[1,3-dioxolane-2,6'-2,3,4,5,7,8-hexahydrochromene] |
| SMILES | CC1CCC2=C(CCC3(C2)OCCO3)O1 |
| InChI | InChI=1S/C12H18O3/c1-9-2-3-10-8-12(13-6-7-14-12)5-4-11(10)15-9/h9H,2-8H2,1H3 |
| InChIKey | VNAXCRDBHQHRGS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |