C12H20O2 — CID 177018399
7-methyl-8-propyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 177018399) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 7-methyl-8-propyl-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 7-methyl-8-propyl-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 177018399 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 7-methyl-8-propyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CCCC1=C(C)CC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H20O2/c1-3-4-11-5-6-12(9-10(11)2)13-7-8-14-12/h3-9H2,1-2H3 |
| InChIKey | XZBYXGJYGQNIES-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|