C18H22ClN3O2 — CID 110311130
(E)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide (PubChem CID 110311130) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is (E)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 110311130 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (E)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(=O)NCCc1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-12(11-13-5-7-14(19)8-6-13)16(23)20-10-9-15-21-17(24-22-15)18(2,3)4/h5-8,11H,9-10H2,1-4H3,(H,20,23)/b12-11+ |
| InChIKey | JKESFMXOCNHALH-VAWYXSNFSA-N |
| XLogP | 3.78 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|