C17H23ClN2O3S — CID 110306654
(E)-3-(4-chlorophenyl)-2-methyl-N-(2-piperidin-1-ylsulfonylethyl)prop-2-enamide (PubChem CID 110306654) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-methyl-N-(2-piperidin-1-ylsulfonylethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-2-methyl-N-(2-piperidin-1-ylsulfonylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 110306654 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-methyl-N-(2-piperidin-1-ylsulfonylethyl)prop-2-enamide |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(=O)NCCS(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O3S/c1-14(13-15-5-7-16(18)8-6-15)17(21)19-9-12-24(22,23)20-10-3-2-4-11-20/h5-8,13H,2-4,9-12H2,1H3,(H,19,21)/b14-13+ |
| InChIKey | UUMRJDZJEOVROK-BUHFOSPRSA-N |
| XLogP | 2.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|