C19H24ClN3O4 — CID 110305634
ethyl 4-[2-[[(E)-3-(4-chlorophenyl)-2-methylprop-2-enoyl]amino]acetyl]piperazine-1-carboxylate (PubChem CID 110305634) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is ethyl 4-[2-[[(E)-3-(4-chlorophenyl)-2-methylprop-2-enoyl]amino]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[[(E)-3-(4-chlorophenyl)-2-methylprop-2-enoyl]amino]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110305634 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 4-[2-[[(E)-3-(4-chlorophenyl)-2-methylprop-2-enoyl]amino]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CNC(=O)/C(C)=C/c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-3-27-19(26)23-10-8-22(9-11-23)17(24)13-21-18(25)14(2)12-15-4-6-16(20)7-5-15/h4-7,12H,3,8-11,13H2,1-2H3,(H,21,25)/b14-12+ |
| InChIKey | BTGLSOALFMHCHN-WYMLVPIESA-N |
| XLogP | 2.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|