C19H17ClN2O4 — CID 110407406
(E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide (PubChem CID 110407406) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is (E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 110407406 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (E)-N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3-(4-chlorophenyl)-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(=O)NCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17ClN2O4/c1-12(8-13-2-4-14(20)5-3-13)19(24)21-10-18(23)22-15-6-7-16-17(9-15)26-11-25-16/h2-9H,10-11H2,1H3,(H,21,24)(H,22,23)/b12-8+ |
| InChIKey | HFDWRPUUWWEYOC-XYOKQWHBSA-N |
| XLogP | 3.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|