C14H16ClNO — CID 110298696
(E)-3-(4-chlorophenyl)-2-methyl-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 110298696) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-methyl-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-2-methyl-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 110298696 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-methyl-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H16ClNO/c1-11(14(17)16-8-2-3-9-16)10-12-4-6-13(15)7-5-12/h4-7,10H,2-3,8-9H2,1H3/b11-10+ |
| InChIKey | YFVHDLQAOGLNOU-ZHACJKMWSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|