C19H23ClN2O3 — CID 110305915
(E)-3-(4-chlorophenyl)-2-methyl-1-[(2S)-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 110305915) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-methyl-1-[(2S)-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-2-methyl-1-[(2S)-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 110305915 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-methyl-1-[(2S)-2-(morpholine-4-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(=O)N1CCC[C@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H23ClN2O3/c1-14(13-15-4-6-16(20)7-5-15)18(23)22-8-2-3-17(22)19(24)21-9-11-25-12-10-21/h4-7,13,17H,2-3,8-12H2,1H3/b14-13+/t17-/m0/s1 |
| InChIKey | XWBXFFGZEIFDFU-CLVCIHKQSA-N |
| XLogP | 2.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|