C16H16ClFN2O2 — CID 110311477
(2-chloro-7-fluoroquinolin-3-yl)-[3-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 110311477) has the molecular formula C16H16ClFN2O2 and a molecular weight of 322.77 g/mol. Its IUPAC name is (2-chloro-7-fluoroquinolin-3-yl)-[3-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-7-fluoroquinolin-3-yl)-[3-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110311477 |
| Molecular Formula | C16H16ClFN2O2 |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (2-chloro-7-fluoroquinolin-3-yl)-[3-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccc(F)cc2nc1Cl)N1CCCC(CO)C1 |
| InChI | InChI=1S/C16H16ClFN2O2/c17-15-13(6-11-3-4-12(18)7-14(11)19-15)16(22)20-5-1-2-10(8-20)9-21/h3-4,6-7,10,21H,1-2,5,8-9H2 |
| InChIKey | FXJPGYYGBCJCKF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|