C17H17ClFN3O3 — CID 110299144
ethyl 4-(2-chloro-7-fluoroquinoline-3-carbonyl)piperazine-1-carboxylate (PubChem CID 110299144) has the molecular formula C17H17ClFN3O3 and a molecular weight of 365.79 g/mol. Its IUPAC name is ethyl 4-(2-chloro-7-fluoroquinoline-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2-chloro-7-fluoroquinoline-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110299144 |
| Molecular Formula | C17H17ClFN3O3 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | ethyl 4-(2-chloro-7-fluoroquinoline-3-carbonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc3ccc(F)cc3nc2Cl)CC1 |
| InChI | InChI=1S/C17H17ClFN3O3/c1-2-25-17(24)22-7-5-21(6-8-22)16(23)13-9-11-3-4-12(19)10-14(11)20-15(13)18/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | VJEMOOZCBJOFOL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|