C25H32N4 — CID 110311592
3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-6-amine (PubChem CID 110311592) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is 3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-6-amine.
| Compound Name | 3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 110311592 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 3-[(3,5-dimethylpiperidin-1-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridin-6-amine |
| SMILES | CC1CC(C)CN(Cc2c(-c3ccc4c(c3)CCCC4)nc3ccc(N)cn23)C1 |
| InChI | InChI=1S/C25H32N4/c1-17-11-18(2)14-28(13-17)16-23-25(27-24-10-9-22(26)15-29(23)24)21-8-7-19-5-3-4-6-20(19)12-21/h7-10,12,15,17-18H,3-6,11,13-14,16,26H2,1-2H3 |
| InChIKey | PZVBKIJJPXCFCX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |