C11H19NOS — CID 11031190
3-methylsulfanyl-N-propan-2-ylcyclohex-2-ene-1-carboxamide (PubChem CID 11031190) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 3-methylsulfanyl-N-propan-2-ylcyclohex-2-ene-1-carboxamide.
| Compound Name | 3-methylsulfanyl-N-propan-2-ylcyclohex-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 11031190 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-methylsulfanyl-N-propan-2-ylcyclohex-2-ene-1-carboxamide |
| SMILES | CSC1=CC(C(=O)NC(C)C)CCC1 |
| InChI | InChI=1S/C11H19NOS/c1-8(2)12-11(13)9-5-4-6-10(7-9)14-3/h7-9H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | SSBVKGYOQYPQRO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |