C19H23NO4 — CID 110312236
N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-3-(furan-2-yl)propanamide (PubChem CID 110312236) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 110312236 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-3-(furan-2-yl)propanamide |
| SMILES | O=C(CCc1ccco1)NCCCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H23NO4/c21-19(9-7-16-5-3-11-22-16)20-10-2-1-4-15-6-8-17-18(14-15)24-13-12-23-17/h3,5-6,8,11,14H,1-2,4,7,9-10,12-13H2,(H,20,21) |
| InChIKey | AKZQFLOTJMFBFU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|