C21H24N2O4 — CID 110633693
N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-4-oxo-4-pyridin-3-ylbutanamide (PubChem CID 110633693) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-4-oxo-4-pyridin-3-ylbutanamide.
| Compound Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-4-oxo-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110633693 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-4-oxo-4-pyridin-3-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccnc1)NCCCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H24N2O4/c24-18(17-5-3-10-22-15-17)7-9-21(25)23-11-2-1-4-16-6-8-19-20(14-16)27-13-12-26-19/h3,5-6,8,10,14-15H,1-2,4,7,9,11-13H2,(H,23,25) |
| InChIKey | OHEHEXVVYKXKPC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|