C17H21N3O3S — CID 110312572
1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-4-carbonitrile (PubChem CID 110312572) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-4-carbonitrile.
| Compound Name | 1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 110312572 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(C(=O)c2ccc(N3CCCCS3(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C17H21N3O3S/c18-13-14-7-10-19(11-8-14)17(21)15-3-5-16(6-4-15)20-9-1-2-12-24(20,22)23/h3-6,14H,1-2,7-12H2 |
| InChIKey | YCRHSLXLGDLRIO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |