C13H10F3N3O3S — CID 110312775
2,3,4-trifluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-nitrobenzamide (PubChem CID 110312775) has the molecular formula C13H10F3N3O3S and a molecular weight of 345.30 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-nitrobenzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 110312775 |
| Molecular Formula | C13H10F3N3O3S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-nitrobenzamide |
| SMILES | Cc1nc(CCNC(=O)c2cc([N+](=O)[O-])c(F)c(F)c2F)cs1 |
| InChI | InChI=1S/C13H10F3N3O3S/c1-6-18-7(5-23-6)2-3-17-13(20)8-4-9(19(21)22)11(15)12(16)10(8)14/h4-5H,2-3H2,1H3,(H,17,20) |
| InChIKey | KXDGMNHYYABMGP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|