C17H19NO6S2 — CID 110315195
ethyl 2-[[2-(4-methoxyphenyl)sulfonyl-2-thiophen-2-ylethyl]amino]-2-oxoacetate (PubChem CID 110315195) has the molecular formula C17H19NO6S2 and a molecular weight of 397.47 g/mol. Its IUPAC name is ethyl 2-[[2-(4-methoxyphenyl)sulfonyl-2-thiophen-2-ylethyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[2-(4-methoxyphenyl)sulfonyl-2-thiophen-2-ylethyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 110315195 |
| Molecular Formula | C17H19NO6S2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | ethyl 2-[[2-(4-methoxyphenyl)sulfonyl-2-thiophen-2-ylethyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC(c1cccs1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H19NO6S2/c1-3-24-17(20)16(19)18-11-15(14-5-4-10-25-14)26(21,22)13-8-6-12(23-2)7-9-13/h4-10,15H,3,11H2,1-2H3,(H,18,19) |
| InChIKey | FJHRDKCICIXXAG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|