C20H24N2O3S — CID 110316144
4-[1-(3,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-yl]morpholine (PubChem CID 110316144) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-yl]morpholine.
| Compound Name | 4-[1-(3,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-yl]morpholine |
|---|---|
| PubChem CID | 110316144 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[1-(3,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-yl]morpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3ccc(N4CCOCC4)cc32)cc1C |
| InChI | InChI=1S/C20H24N2O3S/c1-15-3-6-19(13-16(15)2)26(23,24)22-8-7-17-4-5-18(14-20(17)22)21-9-11-25-12-10-21/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | JQBKTSKIGBVSFE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |