C15H11FN4O5S — CID 110319229
N-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-nitrobenzenesulfonamide (PubChem CID 110319229) has the molecular formula C15H11FN4O5S and a molecular weight of 378.34 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110319229 |
| Molecular Formula | C15H11FN4O5S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NCc2nnc(-c3ccc(F)cc3)o2)c1 |
| InChI | InChI=1S/C15H11FN4O5S/c16-11-6-4-10(5-7-11)15-19-18-14(25-15)9-17-26(23,24)13-3-1-2-12(8-13)20(21)22/h1-8,17H,9H2 |
| InChIKey | DLANHGBNQJRTCP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|