C12H18O5 — CID 11032061
1-O-ethyl 5-O-methyl (E,4E)-4-(methoxymethylidene)-2,3-dimethylpent-2-enedioate (PubChem CID 11032061) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (E,4E)-4-(methoxymethylidene)-2,3-dimethylpent-2-enedioate.
| Compound Name | 1-O-ethyl 5-O-methyl (E,4E)-4-(methoxymethylidene)-2,3-dimethylpent-2-enedioate |
|---|---|
| PubChem CID | 11032061 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (E,4E)-4-(methoxymethylidene)-2,3-dimethylpent-2-enedioate |
| SMILES | CCOC(=O)/C(C)=C(C)/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C12H18O5/c1-6-17-11(13)9(3)8(2)10(7-15-4)12(14)16-5/h7H,6H2,1-5H3/b9-8+,10-7+ |
| InChIKey | UOBYDNZXCVODQU-DGLUDJRXSA-N |
| XLogP | 1.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|