C12H24O3Si — CID 11032120
[(1Z)-1,3-dimethoxy-2-propan-2-ylbuta-1,3-dienoxy]-trimethylsilane (PubChem CID 11032120) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is [(1Z)-1,3-dimethoxy-2-propan-2-ylbuta-1,3-dienoxy]-trimethylsilane.
| Compound Name | [(1Z)-1,3-dimethoxy-2-propan-2-ylbuta-1,3-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11032120 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(1Z)-1,3-dimethoxy-2-propan-2-ylbuta-1,3-dienoxy]-trimethylsilane |
| SMILES | C=C(OC)/C(=C(/OC)O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-9(2)11(10(3)13-4)12(14-5)15-16(6,7)8/h9H,3H2,1-2,4-8H3/b12-11- |
| InChIKey | GYYACDFMDHZVCP-QXMHVHEDSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|