C14H11N3O3S — CID 110322337
phenyl N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]carbamate (PubChem CID 110322337) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is phenyl N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]carbamate.
| Compound Name | phenyl N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 110322337 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | phenyl N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]carbamate |
| SMILES | O=C(NCc1nnc(-c2cccs2)o1)Oc1ccccc1 |
| InChI | InChI=1S/C14H11N3O3S/c18-14(19-10-5-2-1-3-6-10)15-9-12-16-17-13(20-12)11-7-4-8-21-11/h1-8H,9H2,(H,15,18) |
| InChIKey | BIYWFUKSDNIRQD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |