C16H19N3O4 — CID 110324806
N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]morpholine-4-carboxamide (PubChem CID 110324806) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]morpholine-4-carboxamide.
| Compound Name | N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 110324806 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]morpholine-4-carboxamide |
| SMILES | COc1ccc2cc(CNC(=O)N3CCOCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H19N3O4/c1-22-13-3-2-11-8-12(15(20)18-14(11)9-13)10-17-16(21)19-4-6-23-7-5-19/h2-3,8-9H,4-7,10H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | ZVIGLQSFDGEQCH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |