C14H17N3O3 — CID 110324804
3-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea (PubChem CID 110324804) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea.
| Compound Name | 3-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 110324804 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea |
| SMILES | COc1ccc2cc(CNC(=O)N(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H17N3O3/c1-17(2)14(19)15-8-10-6-9-4-5-11(20-3)7-12(9)16-13(10)18/h4-7H,8H2,1-3H3,(H,15,19)(H,16,18) |
| InChIKey | UMFXZHGFLIXRSP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |