C15H19N3O4 — CID 110325039
3-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea (PubChem CID 110325039) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea.
| Compound Name | 3-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 110325039 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,1-dimethylurea |
| SMILES | COc1cc2cc(CNC(=O)N(C)C)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C15H19N3O4/c1-18(2)15(20)16-8-10-5-9-6-12(21-3)13(22-4)7-11(9)17-14(10)19/h5-7H,8H2,1-4H3,(H,16,20)(H,17,19) |
| InChIKey | FPLARDKTZCHOSD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |