C18H24N2O4 — CID 110324991
N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-ethylbutanamide (PubChem CID 110324991) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-ethylbutanamide.
| Compound Name | N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 110324991 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCc1cc2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C18H24N2O4/c1-5-11(6-2)17(21)19-10-13-7-12-8-15(23-3)16(24-4)9-14(12)20-18(13)22/h7-9,11H,5-6,10H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | PUKLXOVYTQOIBV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |