About 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide
2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide (PubChem CID 110608956) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide |
| PubChem CID | 110608956 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide |
| SMILES | Cc1cc2cc(CNC(=O)C(C)C3CC3)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C18H22N2O2/c1-10-6-14-8-15(18(22)20-16(14)7-11(10)2)9-19-17(21)12(3)13-4-5-13/h6-8,12-13H,4-5,9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | JMFQHUGNVUJWOW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide?
The IUPAC name of 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide (CID 110608956) is 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide.
What is the SMILES notation for 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide?
The canonical SMILES for 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide is Cc1cc2cc(CNC(=O)C(C)C3CC3)c(=O)[nH]c2cc1C.
What is the InChIKey of 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide?
The InChIKey is JMFQHUGNVUJWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-10-6-14-8-15(18(22)20-16(14)7-11(10)2)9-19-17(21)12(3)13-4-5-13/h6-8,12-13H,4-5,9H2,1-3H3,(H,19,21)(H,20,22).
What are the key properties of 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide?
2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide has a molecular weight of 298.39 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide is sourced from PubChem (CID 110608956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).