C22H22N2O2 — CID 110616737
(E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbut-2-enamide (PubChem CID 110616737) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbut-2-enamide.
| Compound Name | (E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 110616737 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylbut-2-enamide |
| SMILES | C/C(=C\C(=O)NCc1cc2cc(C)c(C)cc2[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c1-14-9-18-12-19(22(26)24-20(18)10-15(14)2)13-23-21(25)11-16(3)17-7-5-4-6-8-17/h4-12H,13H2,1-3H3,(H,23,25)(H,24,26)/b16-11+ |
| InChIKey | QOXVVKLWFZNOIV-LFIBNONCSA-N |
| XLogP | 3.86 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|