C23H24N2O3 — CID 110616738
(E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)but-2-enamide (PubChem CID 110616738) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)but-2-enamide.
| Compound Name | (E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)but-2-enamide |
|---|---|
| PubChem CID | 110616738 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (E)-N-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)but-2-enamide |
| SMILES | COc1ccc(/C(C)=C/C(=O)NCc2cc3cc(C)c(C)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-14-9-18-12-19(23(27)25-21(18)10-15(14)2)13-24-22(26)11-16(3)17-5-7-20(28-4)8-6-17/h5-12H,13H2,1-4H3,(H,24,26)(H,25,27)/b16-11+ |
| InChIKey | MCMMJIAMGMVTLE-LFIBNONCSA-N |
| XLogP | 3.87 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|