C20H21N3O2 — CID 110326210
1-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-phenylurea (PubChem CID 110326210) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-phenylurea.
| Compound Name | 1-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 110326210 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-phenylurea |
| SMILES | Cc1ccc2cc(CCNC(=O)Nc3ccccc3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C20H21N3O2/c1-13-8-9-15-12-16(19(24)23-18(15)14(13)2)10-11-21-20(25)22-17-6-4-3-5-7-17/h3-9,12H,10-11H2,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | RKPJPTRLOYHPFK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |