C20H20BrN3OS — CID 16814996
1-(3-bromophenyl)-3-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]thiourea (PubChem CID 16814996) has the molecular formula C20H20BrN3OS and a molecular weight of 430.37 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 16814996 |
| Molecular Formula | C20H20BrN3OS |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-(3-bromophenyl)-3-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]thiourea |
| SMILES | Cc1ccc2cc(CCNC(=S)Nc3cccc(Br)c3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C20H20BrN3OS/c1-12-6-7-14-10-15(19(25)24-18(14)13(12)2)8-9-22-20(26)23-17-5-3-4-16(21)11-17/h3-7,10-11H,8-9H2,1-2H3,(H,24,25)(H2,22,23,26) |
| InChIKey | TWHBXHMVMUQVCG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|