C21H24N2O3S — CID 110326427
N-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-4-ethylbenzenesulfonamide (PubChem CID 110326427) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110326427 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCc2cc3c(C)cc(C)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-4-16-5-7-18(8-6-16)27(25,26)22-10-9-17-13-19-15(3)11-14(2)12-20(19)23-21(17)24/h5-8,11-13,22H,4,9-10H2,1-3H3,(H,23,24) |
| InChIKey | QGULEXIKBNAONM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |