C18H19ClN2O2S — CID 113083875
N-[2-(6-chloro-1H-indol-3-yl)ethyl]-4-ethylbenzenesulfonamide (PubChem CID 113083875) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is N-[2-(6-chloro-1H-indol-3-yl)ethyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[2-(6-chloro-1H-indol-3-yl)ethyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113083875 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[2-(6-chloro-1H-indol-3-yl)ethyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCc2c[nH]c3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C18H19ClN2O2S/c1-2-13-3-6-16(7-4-13)24(22,23)21-10-9-14-12-20-18-11-15(19)5-8-17(14)18/h3-8,11-12,20-21H,2,9-10H2,1H3 |
| InChIKey | YJUYNGRYZJUEIA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |