C16H17ClN2O2S2 — CID 113083891
N-[2-(6-chloro-1H-indol-3-yl)ethyl]-5-ethylthiophene-2-sulfonamide (PubChem CID 113083891) has the molecular formula C16H17ClN2O2S2 and a molecular weight of 368.91 g/mol. Its IUPAC name is N-[2-(6-chloro-1H-indol-3-yl)ethyl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[2-(6-chloro-1H-indol-3-yl)ethyl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113083891 |
| Molecular Formula | C16H17ClN2O2S2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | N-[2-(6-chloro-1H-indol-3-yl)ethyl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCc2c[nH]c3cc(Cl)ccc23)s1 |
| InChI | InChI=1S/C16H17ClN2O2S2/c1-2-13-4-6-16(22-13)23(20,21)19-8-7-11-10-18-15-9-12(17)3-5-14(11)15/h3-6,9-10,18-19H,2,7-8H2,1H3 |
| InChIKey | CPWOGXMVNKQFMQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |