C15H19NO3 — CID 11032662
(3aR,6R,6aR)-5-benzyl-2,2,6-trimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one (PubChem CID 11032662) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (3aR,6R,6aR)-5-benzyl-2,2,6-trimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one.
| Compound Name | (3aR,6R,6aR)-5-benzyl-2,2,6-trimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one |
|---|---|
| PubChem CID | 11032662 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (3aR,6R,6aR)-5-benzyl-2,2,6-trimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one |
| SMILES | C[C@@H]1[C@H]2OC(C)(C)O[C@H]2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c1-10-12-13(19-15(2,3)18-12)14(17)16(10)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t10-,12-,13-/m1/s1 |
| InChIKey | UPIHYLNIDQKJNU-RAIGVLPGSA-N |
| XLogP | 1.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |