C24H35NO5Si — CID 14355164
(3aR,6aS)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]spiro[3a,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclohexane]-4,6-dione (PubChem CID 14355164) has the molecular formula C24H35NO5Si and a molecular weight of 445.63 g/mol. Its IUPAC name is (3aR,6aS)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]spiro[3a,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclohexane]-4,6-dione.
| Compound Name | (3aR,6aS)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]spiro[3a,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclohexane]-4,6-dione |
|---|---|
| PubChem CID | 14355164 |
| Molecular Formula | C24H35NO5Si |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (3aR,6aS)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]spiro[3a,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclohexane]-4,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](c1ccccc1)N1C(=O)[C@H]2OC3(CCCCC3)O[C@H]2C1=O |
| InChI | InChI=1S/C24H35NO5Si/c1-23(2,3)31(4,5)28-16-18(17-12-8-6-9-13-17)25-21(26)19-20(22(25)27)30-24(29-19)14-10-7-11-15-24/h6,8-9,12-13,18-20H,7,10-11,14-16H2,1-5H3/t18-,19-,20+/m0/s1 |
| InChIKey | WTEHHAWBECYMJU-SLFFLAALSA-N |
| XLogP | 4.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|