C18H15F3N2O4 — CID 110327902
2,3,4-trifluoro-N-[[3-(3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide (PubChem CID 110327902) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[[3-(3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[[3-(3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 110327902 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[[3-(3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide |
| SMILES | COc1cccc(N2CC(CNC(=O)c3ccc(F)c(F)c3F)OC2=O)c1 |
| InChI | InChI=1S/C18H15F3N2O4/c1-26-11-4-2-3-10(7-11)23-9-12(27-18(23)25)8-22-17(24)13-5-6-14(19)16(21)15(13)20/h2-7,12H,8-9H2,1H3,(H,22,24) |
| InChIKey | VDCFOHFBZJMRAZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|