C12H11F3N2O3 — CID 110710361
2,3,4-trifluoro-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]benzamide (PubChem CID 110710361) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110710361 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2,3,4-trifluoro-N-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]benzamide |
| SMILES | CN1CC(CNC(=O)c2ccc(F)c(F)c2F)OC1=O |
| InChI | InChI=1S/C12H11F3N2O3/c1-17-5-6(20-12(17)19)4-16-11(18)7-2-3-8(13)10(15)9(7)14/h2-3,6H,4-5H2,1H3,(H,16,18) |
| InChIKey | QIEKCDXMWRQOED-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|