C15H22O2S — CID 11032811
1λ6-thiacyclohexadeca-3,14-diyne 1,1-dioxide (PubChem CID 11032811) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 1λ6-thiacyclohexadeca-3,14-diyne 1,1-dioxide.
| Compound Name | 1λ6-thiacyclohexadeca-3,14-diyne 1,1-dioxide |
|---|---|
| PubChem CID | 11032811 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1λ6-thiacyclohexadeca-3,14-diyne 1,1-dioxide |
| SMILES | O=S1(=O)CC#CCCCCCCCCCC#CC1 |
| InChI | InChI=1S/C15H22O2S/c16-18(17)14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-18/h1-9,14-15H2 |
| InChIKey | MZGJRWSSDXBDSP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|