C19H20N4OS — CID 110329127
N-[4-(dimethylamino)phenyl]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 110329127) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110329127 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1nc(-c2cccnc2)sc1CC(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H20N4OS/c1-13-17(25-19(21-13)14-5-4-10-20-12-14)11-18(24)22-15-6-8-16(9-7-15)23(2)3/h4-10,12H,11H2,1-3H3,(H,22,24) |
| InChIKey | HEBRJFOMHJFQQP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|