C26H26N4OS — CID 58398653
2-[4-(dimethylamino)phenyl]-N-[4-methyl-3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)methyl]phenyl]acetamide (PubChem CID 58398653) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-[4-methyl-3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)methyl]phenyl]acetamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-[4-methyl-3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 58398653 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-[4-methyl-3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)methyl]phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccc(N(C)C)cc2)cc1Cc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C26H26N4OS/c1-18-6-9-22(28-25(31)13-19-7-10-23(11-8-19)30(2)3)14-21(18)15-26-29-24(17-32-26)20-5-4-12-27-16-20/h4-12,14,16-17H,13,15H2,1-3H3,(H,28,31) |
| InChIKey | NPIFGUMQUSAJRH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|