C18H25N3OS — CID 110329641
N-[3-(dimethylamino)propyl]-2-[4-methyl-2-(3-methylphenyl)-1,3-thiazol-5-yl]acetamide (PubChem CID 110329641) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[4-methyl-2-(3-methylphenyl)-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[4-methyl-2-(3-methylphenyl)-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 110329641 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[4-methyl-2-(3-methylphenyl)-1,3-thiazol-5-yl]acetamide |
| SMILES | Cc1cccc(-c2nc(C)c(CC(=O)NCCCN(C)C)s2)c1 |
| InChI | InChI=1S/C18H25N3OS/c1-13-7-5-8-15(11-13)18-20-14(2)16(23-18)12-17(22)19-9-6-10-21(3)4/h5,7-8,11H,6,9-10,12H2,1-4H3,(H,19,22) |
| InChIKey | APTGKZOYQIXUAQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|