C17H20N2O2 — CID 110331606
3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-prop-2-enylpropanamide (PubChem CID 110331606) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-prop-2-enylpropanamide.
| Compound Name | 3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 110331606 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)CCc1cc2cc(C)c(C)cc2[nH]c1=O |
| InChI | InChI=1S/C17H20N2O2/c1-4-7-18-16(20)6-5-13-10-14-8-11(2)12(3)9-15(14)19-17(13)21/h4,8-10H,1,5-7H2,2-3H3,(H,18,20)(H,19,21) |
| InChIKey | JHEGXHWIKVVABS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|