C18H24N2O2 — CID 110331658
3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N,N-diethylpropanamide (PubChem CID 110331658) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N,N-diethylpropanamide.
| Compound Name | 3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 110331658 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCc1cc2cc(C)c(C)cc2[nH]c1=O |
| InChI | InChI=1S/C18H24N2O2/c1-5-20(6-2)17(21)8-7-14-11-15-9-12(3)13(4)10-16(15)19-18(14)22/h9-11H,5-8H2,1-4H3,(H,19,22) |
| InChIKey | UGAUYXURQCFXPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |