C22H24N2O2 — CID 110331632
N-benzyl-3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-methylpropanamide (PubChem CID 110331632) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-benzyl-3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-methylpropanamide.
| Compound Name | N-benzyl-3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 110331632 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-benzyl-3-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-N-methylpropanamide |
| SMILES | Cc1cc2cc(CCC(=O)N(C)Cc3ccccc3)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C22H24N2O2/c1-15-11-19-13-18(22(26)23-20(19)12-16(15)2)9-10-21(25)24(3)14-17-7-5-4-6-8-17/h4-8,11-13H,9-10,14H2,1-3H3,(H,23,26) |
| InChIKey | TZJNPVBMJXXZOM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |