C15H10FN3O3 — CID 110331954
N-(3-fluorophenyl)-6-(furan-2-yl)-2-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 110331954) has the molecular formula C15H10FN3O3 and a molecular weight of 299.26 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-(furan-2-yl)-2-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-6-(furan-2-yl)-2-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110331954 |
| Molecular Formula | C15H10FN3O3 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(3-fluorophenyl)-6-(furan-2-yl)-2-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc(-c2ccco2)[nH]c(=O)n1 |
| InChI | InChI=1S/C15H10FN3O3/c16-9-3-1-4-10(7-9)17-14(20)12-8-11(18-15(21)19-12)13-5-2-6-22-13/h1-8H,(H,17,20)(H,18,19,21) |
| InChIKey | MVRHUFCWIUTROS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |